C26H32F2N2 — CID 23470200
6,8-difluoro-N-[(4-hexylphenyl)methyl]-N-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine (PubChem CID 23470200) has the molecular formula C26H32F2N2 and a molecular weight of 410.55 g/mol. Its IUPAC name is 6,8-difluoro-N-[(4-hexylphenyl)methyl]-N-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine.
| Compound Name | 6,8-difluoro-N-[(4-hexylphenyl)methyl]-N-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
|---|---|
| PubChem CID | 23470200 |
| Molecular Formula | C26H32F2N2 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 6,8-difluoro-N-[(4-hexylphenyl)methyl]-N-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
| SMILES | CCCCCCc1ccc(CN(C)C2CCc3[nH]c4c(F)cc(F)cc4c3C2)cc1 |
| InChI | InChI=1S/C26H32F2N2/c1-3-4-5-6-7-18-8-10-19(11-9-18)17-30(2)21-12-13-25-22(16-21)23-14-20(27)15-24(28)26(23)29-25/h8-11,14-15,21,29H,3-7,12-13,16-17H2,1-2H3 |
| InChIKey | QYERZHHVAWVHGG-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|