C27H34N2Ni — CID 166446538
[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]nickel;hexa-1,5-diene (PubChem CID 166446538) has the molecular formula C27H34N2Ni and a molecular weight of 445.28 g/mol. Its IUPAC name is [1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]nickel;hexa-1,5-diene.
| Compound Name | [1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]nickel;hexa-1,5-diene |
|---|---|
| PubChem CID | 166446538 |
| Molecular Formula | C27H34N2Ni |
| Molecular Weight | 445.28 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | [1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]nickel;hexa-1,5-diene |
| SMILES | C=CCCC=C.Cc1cc(C)c(-n2ccn(-c3c(C)cc(C)cc3C)c2=[Ni])c(C)c1 |
| InChI | InChI=1S/C21H24N2.C6H10.Ni/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;1-3-5-6-4-2;/h7-12H,1-6H3;3-4H,1-2,5-6H2; |
| InChIKey | WZVUBTCSTFOPQP-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.28 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|