C33H39O3PS — CID 166448456
[2-(2-adamantyloxy)-6-[(R)-tert-butylsulfinyl]-3-methoxyphenyl]-diphenylphosphane (PubChem CID 166448456) has the molecular formula C33H39O3PS and a molecular weight of 546.71 g/mol. Its IUPAC name is [2-(2-adamantyloxy)-6-[(R)-tert-butylsulfinyl]-3-methoxyphenyl]-diphenylphosphane.
| Compound Name | [2-(2-adamantyloxy)-6-[(R)-tert-butylsulfinyl]-3-methoxyphenyl]-diphenylphosphane |
|---|---|
| PubChem CID | 166448456 |
| Molecular Formula | C33H39O3PS |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | [2-(2-adamantyloxy)-6-[(R)-tert-butylsulfinyl]-3-methoxyphenyl]-diphenylphosphane |
| SMILES | COc1ccc([S@](=O)C(C)(C)C)c(P(c2ccccc2)c2ccccc2)c1OC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C33H39O3PS/c1-33(2,3)38(34)29-16-15-28(35-4)31(36-30-24-18-22-17-23(20-24)21-25(30)19-22)32(29)37(26-11-7-5-8-12-26)27-13-9-6-10-14-27/h5-16,22-25,30H,17-21H2,1-4H3/t22?,23?,24?,25?,30?,38-/m0/s1 |
| InChIKey | GDZRSGYHADJNNI-RLYJYNSYSA-N |
| XLogP | 6.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|