C16H22F2N2O3 — CID 166450749
ethyl 2-[3-amino-4-[(4,4-difluorocyclohexyl)amino]phenoxy]acetate (PubChem CID 166450749) has the molecular formula C16H22F2N2O3 and a molecular weight of 328.36 g/mol. Its IUPAC name is ethyl 2-[3-amino-4-[(4,4-difluorocyclohexyl)amino]phenoxy]acetate.
| Compound Name | ethyl 2-[3-amino-4-[(4,4-difluorocyclohexyl)amino]phenoxy]acetate |
|---|---|
| PubChem CID | 166450749 |
| Molecular Formula | C16H22F2N2O3 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | ethyl 2-[3-amino-4-[(4,4-difluorocyclohexyl)amino]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(NC2CCC(F)(F)CC2)c(N)c1 |
| InChI | InChI=1S/C16H22F2N2O3/c1-2-22-15(21)10-23-12-3-4-14(13(19)9-12)20-11-5-7-16(17,18)8-6-11/h3-4,9,11,20H,2,5-8,10,19H2,1H3 |
| InChIKey | SXIITKWFGGBIGM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|