C20H26N3O3+ — CID 166454026
1-[6-[4,4-bis(prop-2-ynyl)piperazin-4-ium-1-yl]-6-oxohexyl]pyrrole-2,5-dione (PubChem CID 166454026) has the molecular formula C20H26N3O3+ and a molecular weight of 356.45 g/mol. Its IUPAC name is 1-[6-[4,4-bis(prop-2-ynyl)piperazin-4-ium-1-yl]-6-oxohexyl]pyrrole-2,5-dione.
| Compound Name | 1-[6-[4,4-bis(prop-2-ynyl)piperazin-4-ium-1-yl]-6-oxohexyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 166454026 |
| Molecular Formula | C20H26N3O3+ |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 1-[6-[4,4-bis(prop-2-ynyl)piperazin-4-ium-1-yl]-6-oxohexyl]pyrrole-2,5-dione |
| SMILES | C#CC[N+]1(CC#C)CCN(C(=O)CCCCCN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C20H26N3O3/c1-3-14-23(15-4-2)16-12-21(13-17-23)18(24)8-6-5-7-11-22-19(25)9-10-20(22)26/h1-2,9-10H,5-8,11-17H2/q+1 |
| InChIKey | VJKYJUJBPFIRPZ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|