C29H54O10S — CID 166501278
1-O-[2-(2-ethoxyethoxy)ethyl] 5-O-methyl 3-O-octan-3-yl 6-(2,3-dihydroxypropylsulfanyl)-1,5-dimethylhexane-1,3,5-tricarboxylate (PubChem CID 166501278) has the molecular formula C29H54O10S and a molecular weight of 594.81 g/mol. Its IUPAC name is 1-O-[2-(2-ethoxyethoxy)ethyl] 5-O-methyl 3-O-octan-3-yl 6-(2,3-dihydroxypropylsulfanyl)-1,5-dimethylhexane-1,3,5-tricarboxylate.
| Compound Name | 1-O-[2-(2-ethoxyethoxy)ethyl] 5-O-methyl 3-O-octan-3-yl 6-(2,3-dihydroxypropylsulfanyl)-1,5-dimethylhexane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 166501278 |
| Molecular Formula | C29H54O10S |
| Molecular Weight | 594.81 g/mol |
| Exact Mass | 594.34 |
| IUPAC Name | 1-O-[2-(2-ethoxyethoxy)ethyl] 5-O-methyl 3-O-octan-3-yl 6-(2,3-dihydroxypropylsulfanyl)-1,5-dimethylhexane-1,3,5-tricarboxylate |
| SMILES | CCCCCC(CC)OC(=O)C(CC(C)C(=O)OCCOCCOCC)CC(C)(CSCC(O)CO)C(=O)OC |
| InChI | InChI=1S/C29H54O10S/c1-7-10-11-12-25(8-2)39-27(33)23(17-22(4)26(32)38-16-15-37-14-13-36-9-3)18-29(5,28(34)35-6)21-40-20-24(31)19-30/h22-25,30-31H,7-21H2,1-6H3 |
| InChIKey | DTWKXTXSQOXZFO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.81 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|