C16H9F2N3S — CID 166501937
2-[(E)-(2,4-difluorophenyl)sulfanyl-pyrrol-2-ylidenemethyl]-4-isocyano-2H-pyrrole (PubChem CID 166501937) has the molecular formula C16H9F2N3S and a molecular weight of 313.33 g/mol. Its IUPAC name is 2-[(E)-(2,4-difluorophenyl)sulfanyl-pyrrol-2-ylidenemethyl]-4-isocyano-2H-pyrrole.
| Compound Name | 2-[(E)-(2,4-difluorophenyl)sulfanyl-pyrrol-2-ylidenemethyl]-4-isocyano-2H-pyrrole |
|---|---|
| PubChem CID | 166501937 |
| Molecular Formula | C16H9F2N3S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 2-[(E)-(2,4-difluorophenyl)sulfanyl-pyrrol-2-ylidenemethyl]-4-isocyano-2H-pyrrole |
| SMILES | [C-]#[N+]C1=CC(/C(Sc2ccc(F)cc2F)=C2/C=CC=N2)N=C1 |
| InChI | InChI=1S/C16H9F2N3S/c1-19-11-8-14(21-9-11)16(13-3-2-6-20-13)22-15-5-4-10(17)7-12(15)18/h2-9,14H/b16-13+ |
| InChIKey | NCGAYHDKCSIKBU-DTQAZKPQSA-N |
| XLogP | 4.17 |
| TPSA | 29.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|