C18H12F10S2 — CID 130313776
1-[6-(2,4-difluorophenyl)sulfanyl-1,1,3,3,5,5-hexafluorohexyl]sulfanyl-2,4-difluorobenzene (PubChem CID 130313776) has the molecular formula C18H12F10S2 and a molecular weight of 482.41 g/mol. Its IUPAC name is 1-[6-(2,4-difluorophenyl)sulfanyl-1,1,3,3,5,5-hexafluorohexyl]sulfanyl-2,4-difluorobenzene.
| Compound Name | 1-[6-(2,4-difluorophenyl)sulfanyl-1,1,3,3,5,5-hexafluorohexyl]sulfanyl-2,4-difluorobenzene |
|---|---|
| PubChem CID | 130313776 |
| Molecular Formula | C18H12F10S2 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 482.02 |
| IUPAC Name | 1-[6-(2,4-difluorophenyl)sulfanyl-1,1,3,3,5,5-hexafluorohexyl]sulfanyl-2,4-difluorobenzene |
| SMILES | Fc1ccc(SCC(F)(F)CC(F)(F)CC(F)(F)Sc2ccc(F)cc2F)c(F)c1 |
| InChI | InChI=1S/C18H12F10S2/c19-10-1-3-14(12(21)5-10)29-9-17(25,26)7-16(23,24)8-18(27,28)30-15-4-2-11(20)6-13(15)22/h1-6H,7-9H2 |
| InChIKey | MYXKTNJCZLVUPA-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |