About bis(amino(diaminomethylidene)azanium);butanedioate
bis(amino(diaminomethylidene)azanium);butanedioate (PubChem CID 166542017) has the molecular formula C6H18N8O4
and a molecular weight of 266.26 g/mol. Its IUPAC name is bis(amino(diaminomethylidene)azanium);butanedioate.
Molecular Properties
| Compound Name | bis(amino(diaminomethylidene)azanium);butanedioate |
| PubChem CID | 166542017 |
| Molecular Formula | C6H18N8O4 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | bis(amino(diaminomethylidene)azanium);butanedioate |
| SMILES | N[NH+]=C(N)N.N[NH+]=C(N)N.O=C([O-])CCC(=O)[O-] |
| InChI | InChI=1S/C4H6O4.2CH6N4/c5-3(6)1-2-4(7)8;2*2-1(3)5-4/h1-2H2,(H,5,6)(H,7,8);2*4H2,(H4,2,3,5) |
| InChIKey | PASPCKCDLGRXEL-UHFFFAOYSA-N |
| XLogP | -10.31 |
| TPSA | 264.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | -10.31 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(amino(diaminomethylidene)azanium);butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(amino(diaminomethylidene)azanium);butanedioate?
The IUPAC name of bis(amino(diaminomethylidene)azanium);butanedioate (CID 166542017) is bis(amino(diaminomethylidene)azanium);butanedioate.
What is the SMILES notation for bis(amino(diaminomethylidene)azanium);butanedioate?
The canonical SMILES for bis(amino(diaminomethylidene)azanium);butanedioate is N[NH+]=C(N)N.N[NH+]=C(N)N.O=C([O-])CCC(=O)[O-].
What is the InChIKey of bis(amino(diaminomethylidene)azanium);butanedioate?
The InChIKey is PASPCKCDLGRXEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O4.2CH6N4/c5-3(6)1-2-4(7)8;2*2-1(3)5-4/h1-2H2,(H,5,6)(H,7,8);2*4H2,(H4,2,3,5).
What are the key properties of bis(amino(diaminomethylidene)azanium);butanedioate?
bis(amino(diaminomethylidene)azanium);butanedioate has a molecular weight of 266.26 g/mol, XLogP of -10.31, 3 rotatable bonds, 8 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(amino(diaminomethylidene)azanium);butanedioate is sourced from PubChem (CID 166542017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).