C21H23N3O4 — CID 16659698
6-[(3R)-2,5-dioxo-3-phenyl-3,4-dihydro-1,4-benzodiazepin-1-yl]-N-hydroxyhexanamide (PubChem CID 16659698) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 6-[(3R)-2,5-dioxo-3-phenyl-3,4-dihydro-1,4-benzodiazepin-1-yl]-N-hydroxyhexanamide.
| Compound Name | 6-[(3R)-2,5-dioxo-3-phenyl-3,4-dihydro-1,4-benzodiazepin-1-yl]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 16659698 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 6-[(3R)-2,5-dioxo-3-phenyl-3,4-dihydro-1,4-benzodiazepin-1-yl]-N-hydroxyhexanamide |
| SMILES | O=C(CCCCCN1C(=O)[C@@H](c2ccccc2)NC(=O)c2ccccc21)NO |
| InChI | InChI=1S/C21H23N3O4/c25-18(23-28)13-5-2-8-14-24-17-12-7-6-11-16(17)20(26)22-19(21(24)27)15-9-3-1-4-10-15/h1,3-4,6-7,9-12,19,28H,2,5,8,13-14H2,(H,22,26)(H,23,25)/t19-/m1/s1 |
| InChIKey | DZNBAGSWWYXHKP-LJQANCHMSA-N |
| XLogP | 2.57 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|