C19H20ClN5 — CID 166628901
2-[2-(4-chlorophenyl)ethyl]-1-[(E)-(7-methyl-1H-indol-3-yl)methylideneamino]guanidine (PubChem CID 166628901) has the molecular formula C19H20ClN5 and a molecular weight of 353.86 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)ethyl]-1-[(E)-(7-methyl-1H-indol-3-yl)methylideneamino]guanidine.
| Compound Name | 2-[2-(4-chlorophenyl)ethyl]-1-[(E)-(7-methyl-1H-indol-3-yl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 166628901 |
| Molecular Formula | C19H20ClN5 |
| Molecular Weight | 353.86 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 2-[2-(4-chlorophenyl)ethyl]-1-[(E)-(7-methyl-1H-indol-3-yl)methylideneamino]guanidine |
| SMILES | Cc1cccc2c(/C=N/N/C(N)=N/CCc3ccc(Cl)cc3)c[nH]c12 |
| InChI | InChI=1S/C19H20ClN5/c1-13-3-2-4-17-15(11-23-18(13)17)12-24-25-19(21)22-10-9-14-5-7-16(20)8-6-14/h2-8,11-12,23H,9-10H2,1H3,(H3,21,22,25)/b24-12+ |
| InChIKey | XJRUAPDZZCCZJL-WYMPLXKRSA-N |
| XLogP | 3.61 |
| TPSA | 78.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.86 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|