C25H31N7O2S — CID 166628956
3-[[6-methyl-2-[[2-(2-morpholin-4-ylethylamino)-1,3-benzothiazol-6-yl]amino]quinazolin-4-yl]amino]propan-1-ol (PubChem CID 166628956) has the molecular formula C25H31N7O2S and a molecular weight of 493.64 g/mol. Its IUPAC name is 3-[[6-methyl-2-[[2-(2-morpholin-4-ylethylamino)-1,3-benzothiazol-6-yl]amino]quinazolin-4-yl]amino]propan-1-ol.
| Compound Name | 3-[[6-methyl-2-[[2-(2-morpholin-4-ylethylamino)-1,3-benzothiazol-6-yl]amino]quinazolin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 166628956 |
| Molecular Formula | C25H31N7O2S |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | 3-[[6-methyl-2-[[2-(2-morpholin-4-ylethylamino)-1,3-benzothiazol-6-yl]amino]quinazolin-4-yl]amino]propan-1-ol |
| SMILES | Cc1ccc2nc(Nc3ccc4nc(NCCN5CCOCC5)sc4c3)nc(NCCCO)c2c1 |
| InChI | InChI=1S/C25H31N7O2S/c1-17-3-5-20-19(15-17)23(26-7-2-12-33)31-24(29-20)28-18-4-6-21-22(16-18)35-25(30-21)27-8-9-32-10-13-34-14-11-32/h3-6,15-16,33H,2,7-14H2,1H3,(H,27,30)(H2,26,28,29,31) |
| InChIKey | QGTKGNHMPADEDJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|