C14H24BNO2S — CID 166640378
(3S)-N-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-thiophen-2-ylpropan-1-amine (PubChem CID 166640378) has the molecular formula C14H24BNO2S and a molecular weight of 281.23 g/mol. Its IUPAC name is (3S)-N-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-thiophen-2-ylpropan-1-amine.
| Compound Name | (3S)-N-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 166640378 |
| Molecular Formula | C14H24BNO2S |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | (3S)-N-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-thiophen-2-ylpropan-1-amine |
| SMILES | CNCC[C@H](B1OC(C)(C)C(C)(C)O1)c1cccs1 |
| InChI | InChI=1S/C14H24BNO2S/c1-13(2)14(3,4)18-15(17-13)11(8-9-16-5)12-7-6-10-19-12/h6-7,10-11,16H,8-9H2,1-5H3/t11-/m0/s1 |
| InChIKey | NVIVCKKLNLSIBZ-NSHDSACASA-N |
| XLogP | 3.07 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|