C15H12BrCl2NO6S — CID 166666184
5-bromo-1,3-dichloro-2-[4-hydroxy-3-[(2-methoxy-2-oxoethyl)-sulfinoamino]phenoxy]benzene (PubChem CID 166666184) has the molecular formula C15H12BrCl2NO6S and a molecular weight of 485.14 g/mol. Its IUPAC name is 5-bromo-1,3-dichloro-2-[4-hydroxy-3-[(2-methoxy-2-oxoethyl)-sulfinoamino]phenoxy]benzene.
| Compound Name | 5-bromo-1,3-dichloro-2-[4-hydroxy-3-[(2-methoxy-2-oxoethyl)-sulfinoamino]phenoxy]benzene |
|---|---|
| PubChem CID | 166666184 |
| Molecular Formula | C15H12BrCl2NO6S |
| Molecular Weight | 485.14 g/mol |
| Exact Mass | 482.89 |
| IUPAC Name | 5-bromo-1,3-dichloro-2-[4-hydroxy-3-[(2-methoxy-2-oxoethyl)-sulfinoamino]phenoxy]benzene |
| SMILES | COC(=O)CN(c1cc(Oc2c(Cl)cc(Br)cc2Cl)ccc1O)S(=O)O |
| InChI | InChI=1S/C15H12BrCl2NO6S/c1-24-14(21)7-19(26(22)23)12-6-9(2-3-13(12)20)25-15-10(17)4-8(16)5-11(15)18/h2-6,20H,7H2,1H3,(H,22,23) |
| InChIKey | ICHXBXYEXRGTQY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.14 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|