C23H42N4O5 — CID 166670735
tert-butyl N-[[[8-[(2-methylpropan-2-yl)oxycarbonylamino]octyl-prop-2-enylcarbamoyl]amino]methylidene]carbamate (PubChem CID 166670735) has the molecular formula C23H42N4O5 and a molecular weight of 454.61 g/mol. Its IUPAC name is tert-butyl N-[[[8-[(2-methylpropan-2-yl)oxycarbonylamino]octyl-prop-2-enylcarbamoyl]amino]methylidene]carbamate.
| Compound Name | tert-butyl N-[[[8-[(2-methylpropan-2-yl)oxycarbonylamino]octyl-prop-2-enylcarbamoyl]amino]methylidene]carbamate |
|---|---|
| PubChem CID | 166670735 |
| Molecular Formula | C23H42N4O5 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.32 |
| IUPAC Name | tert-butyl N-[[[8-[(2-methylpropan-2-yl)oxycarbonylamino]octyl-prop-2-enylcarbamoyl]amino]methylidene]carbamate |
| SMILES | C=CCN(CCCCCCCCNC(=O)OC(C)(C)C)C(=O)NC=NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H42N4O5/c1-8-16-27(19(28)25-18-26-21(30)32-23(5,6)7)17-14-12-10-9-11-13-15-24-20(29)31-22(2,3)4/h8,18H,1,9-17H2,2-7H3,(H,24,29)(H,25,26,28,30) |
| InChIKey | FTUSGLPBUJSRNA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|