C12H24NOP — CID 166687858
(1,5-dimethyl-2-morpholin-4-ylcyclohexyl)phosphane (PubChem CID 166687858) has the molecular formula C12H24NOP and a molecular weight of 229.30 g/mol. Its IUPAC name is (1,5-dimethyl-2-morpholin-4-ylcyclohexyl)phosphane.
| Compound Name | (1,5-dimethyl-2-morpholin-4-ylcyclohexyl)phosphane |
|---|---|
| PubChem CID | 166687858 |
| Molecular Formula | C12H24NOP |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | (1,5-dimethyl-2-morpholin-4-ylcyclohexyl)phosphane |
| SMILES | CC1CCC(N2CCOCC2)C(C)(P)C1 |
| InChI | InChI=1S/C12H24NOP/c1-10-3-4-11(12(2,15)9-10)13-5-7-14-8-6-13/h10-11H,3-9,15H2,1-2H3 |
| InChIKey | OFLMBVWJKWSMHH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|