C23H21ClFN5O3S — CID 166721887
N-[1-[4-chloro-2-(4-fluorophenyl)-1H-imidazol-5-yl]-7-(1,3-oxazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide (PubChem CID 166721887) has the molecular formula C23H21ClFN5O3S and a molecular weight of 501.97 g/mol. Its IUPAC name is N-[1-[4-chloro-2-(4-fluorophenyl)-1H-imidazol-5-yl]-7-(1,3-oxazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[1-[4-chloro-2-(4-fluorophenyl)-1H-imidazol-5-yl]-7-(1,3-oxazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 166721887 |
| Molecular Formula | C23H21ClFN5O3S |
| Molecular Weight | 501.97 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | N-[1-[4-chloro-2-(4-fluorophenyl)-1H-imidazol-5-yl]-7-(1,3-oxazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide |
| SMILES | O=C(CCCCCC(NC(=O)c1cncs1)c1[nH]c(-c2ccc(F)cc2)nc1Cl)c1ncco1 |
| InChI | InChI=1S/C23H21ClFN5O3S/c24-20-19(29-21(30-20)14-6-8-15(25)9-7-14)16(28-22(32)18-12-26-13-34-18)4-2-1-3-5-17(31)23-27-10-11-33-23/h6-13,16H,1-5H2,(H,28,32)(H,29,30) |
| InChIKey | LFGDEAWQTQUGLL-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.97 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|