C16H14N2O5 — CID 166786732
(E)-3-[1,3-dioxo-2-(6-oxopiperidin-3-yl)isoindol-5-yl]prop-2-enoic acid (PubChem CID 166786732) has the molecular formula C16H14N2O5 and a molecular weight of 314.30 g/mol. Its IUPAC name is (E)-3-[1,3-dioxo-2-(6-oxopiperidin-3-yl)isoindol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1,3-dioxo-2-(6-oxopiperidin-3-yl)isoindol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 166786732 |
| Molecular Formula | C16H14N2O5 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | (E)-3-[1,3-dioxo-2-(6-oxopiperidin-3-yl)isoindol-5-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc2c(c1)C(=O)N(C1CCC(=O)NC1)C2=O |
| InChI | InChI=1S/C16H14N2O5/c19-13-5-3-10(8-17-13)18-15(22)11-4-1-9(2-6-14(20)21)7-12(11)16(18)23/h1-2,4,6-7,10H,3,5,8H2,(H,17,19)(H,20,21)/b6-2+ |
| InChIKey | MIKUQNIAYWHZSS-QHHAFSJGSA-N |
| XLogP | 0.66 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|