C22H23ClF4N4O2 — CID 166816137
2-[(2-chloroacetyl)-[2-(3,5-difluorophenyl)ethyl]amino]-N-(4,4-difluorocyclohexyl)-2-pyrimidin-5-ylacetamide (PubChem CID 166816137) has the molecular formula C22H23ClF4N4O2 and a molecular weight of 486.90 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-[2-(3,5-difluorophenyl)ethyl]amino]-N-(4,4-difluorocyclohexyl)-2-pyrimidin-5-ylacetamide.
| Compound Name | 2-[(2-chloroacetyl)-[2-(3,5-difluorophenyl)ethyl]amino]-N-(4,4-difluorocyclohexyl)-2-pyrimidin-5-ylacetamide |
|---|---|
| PubChem CID | 166816137 |
| Molecular Formula | C22H23ClF4N4O2 |
| Molecular Weight | 486.90 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 2-[(2-chloroacetyl)-[2-(3,5-difluorophenyl)ethyl]amino]-N-(4,4-difluorocyclohexyl)-2-pyrimidin-5-ylacetamide |
| SMILES | O=C(NC1CCC(F)(F)CC1)C(c1cncnc1)N(CCc1cc(F)cc(F)c1)C(=O)CCl |
| InChI | InChI=1S/C22H23ClF4N4O2/c23-10-19(32)31(6-3-14-7-16(24)9-17(25)8-14)20(15-11-28-13-29-12-15)21(33)30-18-1-4-22(26,27)5-2-18/h7-9,11-13,18,20H,1-6,10H2,(H,30,33) |
| InChIKey | ZYVPDEPUAKSKGY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.90 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|