C14H26N2 — CID 166844209
(2Z,4Z,6Z)-3-N,3-N-dipropylocta-2,4,6-triene-1,3-diamine (PubChem CID 166844209) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is (2Z,4Z,6Z)-3-N,3-N-dipropylocta-2,4,6-triene-1,3-diamine.
| Compound Name | (2Z,4Z,6Z)-3-N,3-N-dipropylocta-2,4,6-triene-1,3-diamine |
|---|---|
| PubChem CID | 166844209 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | (2Z,4Z,6Z)-3-N,3-N-dipropylocta-2,4,6-triene-1,3-diamine |
| SMILES | C/C=C\C=C/C(=C/CN)N(CCC)CCC |
| InChI | InChI=1S/C14H26N2/c1-4-7-8-9-14(10-11-15)16(12-5-2)13-6-3/h4,7-10H,5-6,11-13,15H2,1-3H3/b7-4-,9-8-,14-10- |
| InChIKey | PSBGRRUPNXZZCX-JGLDSLNYSA-N |
| XLogP | 3.08 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|