C46H42N4 — CID 166864589
11-[4-[6-(3-cyclohex-2-en-1-ylphenyl)-4-phenyl-1,4-dihydro-1,3,5-triazin-2-yl]phenyl]-12-azatetracyclo[13.4.1.02,7.08,14]icosa-1(20),2(7),3,8(14),12,16,18-heptaene (PubChem CID 166864589) has the molecular formula C46H42N4 and a molecular weight of 650.87 g/mol. Its IUPAC name is 11-[4-[6-(3-cyclohex-2-en-1-ylphenyl)-4-phenyl-1,4-dihydro-1,3,5-triazin-2-yl]phenyl]-12-azatetracyclo[13.4.1.02,7.08,14]icosa-1(20),2(7),3,8(14),12,16,18-heptaene.
| Compound Name | 11-[4-[6-(3-cyclohex-2-en-1-ylphenyl)-4-phenyl-1,4-dihydro-1,3,5-triazin-2-yl]phenyl]-12-azatetracyclo[13.4.1.02,7.08,14]icosa-1(20),2(7),3,8(14),12,16,18-heptaene |
|---|---|
| PubChem CID | 166864589 |
| Molecular Formula | C46H42N4 |
| Molecular Weight | 650.87 g/mol |
| Exact Mass | 650.34 |
| IUPAC Name | 11-[4-[6-(3-cyclohex-2-en-1-ylphenyl)-4-phenyl-1,4-dihydro-1,3,5-triazin-2-yl]phenyl]-12-azatetracyclo[13.4.1.02,7.08,14]icosa-1(20),2(7),3,8(14),12,16,18-heptaene |
| SMILES | C1=CC2=CC(C=C1)C1=C(CCC(c3ccc(C4=NC(c5ccccc5)N=C(c5cccc(C6C=CCCC6)c5)N4)cc3)N=C1)C1=C2C=CCC1 |
| InChI | InChI=1S/C46H42N4/c1-3-12-31(13-4-1)35-18-11-19-38(28-35)46-49-44(33-14-5-2-6-15-33)48-45(50-46)34-24-22-32(23-25-34)43-27-26-41-40-21-10-9-20-39(40)36-16-7-8-17-37(29-36)42(41)30-47-43/h2-3,5-9,11-12,14-20,22-25,28-31,37,43-44H,1,4,10,13,21,26-27H2,(H,48,49,50) |
| InChIKey | JIXSFFCRSYKDCN-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 49.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.87 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|