C30H39ClN8O3 — CID 166870276
(11R)-6-(6-amino-2-pyridinyl)-7-chloro-4-[2,2-dimethyl-4-(4-methylpiperazin-1-yl)pyrrolidin-1-yl]-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one (PubChem CID 166870276) has the molecular formula C30H39ClN8O3 and a molecular weight of 595.15 g/mol. Its IUPAC name is (11R)-6-(6-amino-2-pyridinyl)-7-chloro-4-[2,2-dimethyl-4-(4-methylpiperazin-1-yl)pyrrolidin-1-yl]-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one.
| Compound Name | (11R)-6-(6-amino-2-pyridinyl)-7-chloro-4-[2,2-dimethyl-4-(4-methylpiperazin-1-yl)pyrrolidin-1-yl]-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
|---|---|
| PubChem CID | 166870276 |
| Molecular Formula | C30H39ClN8O3 |
| Molecular Weight | 595.15 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | (11R)-6-(6-amino-2-pyridinyl)-7-chloro-4-[2,2-dimethyl-4-(4-methylpiperazin-1-yl)pyrrolidin-1-yl]-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
| SMILES | C=CC(=O)N1CCN2C(=O)c3c(N4CC(N5CCN(C)CC5)CC4(C)C)nc(-c4cccc(N)n4)c(Cl)c3OC[C@H]2C1 |
| InChI | InChI=1S/C30H39ClN8O3/c1-5-23(40)37-13-14-38-20(16-37)18-42-27-24(29(38)41)28(34-26(25(27)31)21-7-6-8-22(32)33-21)39-17-19(15-30(39,2)3)36-11-9-35(4)10-12-36/h5-8,19-20H,1,9-18H2,2-4H3,(H2,32,33)/t19?,20-/m1/s1 |
| InChIKey | PHEWOXGMXNANRS-GFOWMXPYSA-N |
| XLogP | 2.22 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.15 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|