C24H27ClN6O4 — CID 166870353
(11R)-6-(6-amino-4-methyl-2-pyridinyl)-7-chloro-4-morpholin-4-yl-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one (PubChem CID 166870353) has the molecular formula C24H27ClN6O4 and a molecular weight of 498.97 g/mol. Its IUPAC name is (11R)-6-(6-amino-4-methyl-2-pyridinyl)-7-chloro-4-morpholin-4-yl-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one.
| Compound Name | (11R)-6-(6-amino-4-methyl-2-pyridinyl)-7-chloro-4-morpholin-4-yl-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
|---|---|
| PubChem CID | 166870353 |
| Molecular Formula | C24H27ClN6O4 |
| Molecular Weight | 498.97 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | (11R)-6-(6-amino-4-methyl-2-pyridinyl)-7-chloro-4-morpholin-4-yl-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
| SMILES | C=CC(=O)N1CCN2C(=O)c3c(N4CCOCC4)nc(-c4cc(C)cc(N)n4)c(Cl)c3OC[C@H]2C1 |
| InChI | InChI=1S/C24H27ClN6O4/c1-3-18(32)30-4-5-31-15(12-30)13-35-22-19(24(31)33)23(29-6-8-34-9-7-29)28-21(20(22)25)16-10-14(2)11-17(26)27-16/h3,10-11,15H,1,4-9,12-13H2,2H3,(H2,26,27)/t15-/m1/s1 |
| InChIKey | ZNSNTMHNYURQPR-OAHLLOKOSA-N |
| XLogP | 1.76 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.97 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|