C25H29N5O6 — CID 166877639
6-[[5-(dihydroxymethyl)-2-[(2,4-dimethoxyphenyl)methylamino]-4-pyridinyl]amino]-3,3,8-trimethyl-2H-imidazo[1,5-a]pyridine-1,5-dione (PubChem CID 166877639) has the molecular formula C25H29N5O6 and a molecular weight of 495.54 g/mol. Its IUPAC name is 6-[[5-(dihydroxymethyl)-2-[(2,4-dimethoxyphenyl)methylamino]-4-pyridinyl]amino]-3,3,8-trimethyl-2H-imidazo[1,5-a]pyridine-1,5-dione.
| Compound Name | 6-[[5-(dihydroxymethyl)-2-[(2,4-dimethoxyphenyl)methylamino]-4-pyridinyl]amino]-3,3,8-trimethyl-2H-imidazo[1,5-a]pyridine-1,5-dione |
|---|---|
| PubChem CID | 166877639 |
| Molecular Formula | C25H29N5O6 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 6-[[5-(dihydroxymethyl)-2-[(2,4-dimethoxyphenyl)methylamino]-4-pyridinyl]amino]-3,3,8-trimethyl-2H-imidazo[1,5-a]pyridine-1,5-dione |
| SMILES | COc1ccc(CNc2cc(Nc3cc(C)c4n(c3=O)C(C)(C)NC4=O)c(C(O)O)cn2)c(OC)c1 |
| InChI | InChI=1S/C25H29N5O6/c1-13-8-18(23(32)30-21(13)22(31)29-25(30,2)3)28-17-10-20(27-12-16(17)24(33)34)26-11-14-6-7-15(35-4)9-19(14)36-5/h6-10,12,24,33-34H,11H2,1-5H3,(H,29,31)(H2,26,27,28) |
| InChIKey | JURPDVXFAZYLCW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 146.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|