C27H38BrN3O5 — CID 166879149
(2R)-1-[4-[2-[3-bromo-4-(3-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-3-[methylamino-(3-methyl-1-nitrosobut-2-en-2-yl)amino]propan-2-ol (PubChem CID 166879149) has the molecular formula C27H38BrN3O5 and a molecular weight of 564.52 g/mol. Its IUPAC name is (2R)-1-[4-[2-[3-bromo-4-(3-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-3-[methylamino-(3-methyl-1-nitrosobut-2-en-2-yl)amino]propan-2-ol.
| Compound Name | (2R)-1-[4-[2-[3-bromo-4-(3-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-3-[methylamino-(3-methyl-1-nitrosobut-2-en-2-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 166879149 |
| Molecular Formula | C27H38BrN3O5 |
| Molecular Weight | 564.52 g/mol |
| Exact Mass | 563.20 |
| IUPAC Name | (2R)-1-[4-[2-[3-bromo-4-(3-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-3-[methylamino-(3-methyl-1-nitrosobut-2-en-2-yl)amino]propan-2-ol |
| SMILES | CNN(C[C@@H](O)COc1ccc(C(C)(C)c2ccc(OCCCO)c(Br)c2)cc1)C(CN=O)=C(C)C |
| InChI | InChI=1S/C27H38BrN3O5/c1-19(2)25(16-30-34)31(29-5)17-22(33)18-36-23-10-7-20(8-11-23)27(3,4)21-9-12-26(24(28)15-21)35-14-6-13-32/h7-12,15,22,29,32-33H,6,13-14,16-18H2,1-5H3/t22-/m1/s1 |
| InChIKey | VYBITNHZJNTJQY-JOCHJYFZSA-N |
| XLogP | 4.77 |
| TPSA | 103.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|