C9H11N3S — CID 166924228
4-imino-2,3-dihydro-1,5-benzothiazepin-5-amine (PubChem CID 166924228) has the molecular formula C9H11N3S and a molecular weight of 193.28 g/mol. Its IUPAC name is 4-imino-2,3-dihydro-1,5-benzothiazepin-5-amine.
| Compound Name | 4-imino-2,3-dihydro-1,5-benzothiazepin-5-amine |
|---|---|
| PubChem CID | 166924228 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.28 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 4-imino-2,3-dihydro-1,5-benzothiazepin-5-amine |
| SMILES | [H]/N=C1\CCSc2ccccc2N1N |
| InChI | InChI=1S/C9H11N3S/c10-9-5-6-13-8-4-2-1-3-7(8)12(9)11/h1-4,10H,5-6,11H2/b10-9+ |
| InChIKey | SHOSFIYMMPSIGU-MDZDMXLPSA-N |
| XLogP | 1.84 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|