About (E)-7-bromododec-7-ene-2,6-dione
(E)-7-bromododec-7-ene-2,6-dione (PubChem CID 166959864) has the molecular formula C12H19BrO2
and a molecular weight of 275.19 g/mol. Its IUPAC name is (E)-7-bromododec-7-ene-2,6-dione.
Molecular Properties
| Compound Name | (E)-7-bromododec-7-ene-2,6-dione |
| PubChem CID | 166959864 |
| Molecular Formula | C12H19BrO2 |
| Molecular Weight | 275.19 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | (E)-7-bromododec-7-ene-2,6-dione |
| SMILES | CCCC/C=C(/Br)C(=O)CCCC(C)=O |
| InChI | InChI=1S/C12H19BrO2/c1-3-4-5-8-11(13)12(15)9-6-7-10(2)14/h8H,3-7,9H2,1-2H3/b11-8+ |
| InChIKey | QGCIGYXSJDOLOT-DHZHZOJOSA-N |
| XLogP | 3.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.19 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-7-bromododec-7-ene-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-7-bromododec-7-ene-2,6-dione?
The IUPAC name of (E)-7-bromododec-7-ene-2,6-dione (CID 166959864) is (E)-7-bromododec-7-ene-2,6-dione.
What is the SMILES notation for (E)-7-bromododec-7-ene-2,6-dione?
The canonical SMILES for (E)-7-bromododec-7-ene-2,6-dione is CCCC/C=C(/Br)C(=O)CCCC(C)=O.
What is the InChIKey of (E)-7-bromododec-7-ene-2,6-dione?
The InChIKey is QGCIGYXSJDOLOT-DHZHZOJOSA-N. The full InChI is InChI=1S/C12H19BrO2/c1-3-4-5-8-11(13)12(15)9-6-7-10(2)14/h8H,3-7,9H2,1-2H3/b11-8+.
What are the key properties of (E)-7-bromododec-7-ene-2,6-dione?
(E)-7-bromododec-7-ene-2,6-dione has a molecular weight of 275.19 g/mol, XLogP of 3.78, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-7-bromododec-7-ene-2,6-dione is sourced from PubChem (CID 166959864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).