C15H21N5 — CID 166967965
(Z)-1-[(2-ethylcyclopentyl)methyl]-N-(methylideneamino)-5H-pyrrolo[2,3-b]pyrazin-2-imine (PubChem CID 166967965) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is (Z)-1-[(2-ethylcyclopentyl)methyl]-N-(methylideneamino)-5H-pyrrolo[2,3-b]pyrazin-2-imine.
| Compound Name | (Z)-1-[(2-ethylcyclopentyl)methyl]-N-(methylideneamino)-5H-pyrrolo[2,3-b]pyrazin-2-imine |
|---|---|
| PubChem CID | 166967965 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | (Z)-1-[(2-ethylcyclopentyl)methyl]-N-(methylideneamino)-5H-pyrrolo[2,3-b]pyrazin-2-imine |
| SMILES | C=N/N=c1/cnc2[nH]ccc2n1CC1CCCC1CC |
| InChI | InChI=1S/C15H21N5/c1-3-11-5-4-6-12(11)10-20-13-7-8-17-15(13)18-9-14(20)19-16-2/h7-9,11-12,17H,2-6,10H2,1H3/b19-14- |
| InChIKey | OLKNUTIZOGVECK-RGEXLXHISA-N |
| XLogP | 2.71 |
| TPSA | 58.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|