C15H24FN — CID 166983561
2-(3-fluorocyclohexa-1,3-dien-1-yl)-N-[(2-methylcyclopentyl)methyl]ethanamine (PubChem CID 166983561) has the molecular formula C15H24FN and a molecular weight of 237.36 g/mol. Its IUPAC name is 2-(3-fluorocyclohexa-1,3-dien-1-yl)-N-[(2-methylcyclopentyl)methyl]ethanamine.
| Compound Name | 2-(3-fluorocyclohexa-1,3-dien-1-yl)-N-[(2-methylcyclopentyl)methyl]ethanamine |
|---|---|
| PubChem CID | 166983561 |
| Molecular Formula | C15H24FN |
| Molecular Weight | 237.36 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | 2-(3-fluorocyclohexa-1,3-dien-1-yl)-N-[(2-methylcyclopentyl)methyl]ethanamine |
| SMILES | CC1CCCC1CNCCC1=CC(F)=CCC1 |
| InChI | InChI=1S/C15H24FN/c1-12-4-2-6-14(12)11-17-9-8-13-5-3-7-15(16)10-13/h7,10,12,14,17H,2-6,8-9,11H2,1H3 |
| InChIKey | DARTVCBTPLPORT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|