C8H3BrIN3 — CID 167037554
6-bromo-8-iodoimidazo[1,2-a]pyridine-7-carbonitrile (PubChem CID 167037554) has the molecular formula C8H3BrIN3 and a molecular weight of 347.94 g/mol. Its IUPAC name is 6-bromo-8-iodoimidazo[1,2-a]pyridine-7-carbonitrile.
| Compound Name | 6-bromo-8-iodoimidazo[1,2-a]pyridine-7-carbonitrile |
|---|---|
| PubChem CID | 167037554 |
| Molecular Formula | C8H3BrIN3 |
| Molecular Weight | 347.94 g/mol |
| Exact Mass | 346.86 |
| IUPAC Name | 6-bromo-8-iodoimidazo[1,2-a]pyridine-7-carbonitrile |
| SMILES | N#Cc1c(Br)cn2ccnc2c1I |
| InChI | InChI=1S/C8H3BrIN3/c9-6-4-13-2-1-12-8(13)7(10)5(6)3-11/h1-2,4H |
| InChIKey | TZKDHJFAADKRJT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 41.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.94 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|