C43H49N3O10 — CID 167049054
(2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-[4-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(2-phenylmethoxyethyl)oxan-2-yl]triazol-1-yl]oxane-3,4,5-triol (PubChem CID 167049054) has the molecular formula C43H49N3O10 and a molecular weight of 767.88 g/mol. Its IUPAC name is (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-[4-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(2-phenylmethoxyethyl)oxan-2-yl]triazol-1-yl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-[4-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(2-phenylmethoxyethyl)oxan-2-yl]triazol-1-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 167049054 |
| Molecular Formula | C43H49N3O10 |
| Molecular Weight | 767.88 g/mol |
| Exact Mass | 767.34 |
| IUPAC Name | (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-[4-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(2-phenylmethoxyethyl)oxan-2-yl]triazol-1-yl]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@H](n2cc([C@H]3O[C@H](CCOCc4ccccc4)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)C3OCc3ccccc3)nn2)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C43H49N3O10/c47-24-35-36(48)37(49)38(50)43(56-35)46-23-33(44-45-46)39-41(53-27-31-17-9-3-10-18-31)42(54-28-32-19-11-4-12-20-32)40(52-26-30-15-7-2-8-16-30)34(55-39)21-22-51-25-29-13-5-1-6-14-29/h1-20,23,34-43,47-50H,21-22,24-28H2/t34-,35-,36-,37+,38+,39-,40-,41?,42+,43+/m1/s1 |
| InChIKey | KMNSUSMHTABJQJ-VICAVYHXSA-N |
| XLogP | 4.05 |
| TPSA | 167.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.88 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|