C36H43N3O9 — CID 90365527
(2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-[4-[(2S,3R,4R,5S,6R)-3-methyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]triazol-1-yl]oxane-3,4,5-triol (PubChem CID 90365527) has the molecular formula C36H43N3O9 and a molecular weight of 661.75 g/mol. Its IUPAC name is (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-[4-[(2S,3R,4R,5S,6R)-3-methyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]triazol-1-yl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-[4-[(2S,3R,4R,5S,6R)-3-methyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]triazol-1-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 90365527 |
| Molecular Formula | C36H43N3O9 |
| Molecular Weight | 661.75 g/mol |
| Exact Mass | 661.30 |
| IUPAC Name | (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-[4-[(2S,3R,4R,5S,6R)-3-methyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]triazol-1-yl]oxane-3,4,5-triol |
| SMILES | C[C@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[C@@H]1c1cn([C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)nn1 |
| InChI | InChI=1S/C36H43N3O9/c1-23-33(27-17-39(38-37-27)36-32(43)31(42)30(41)28(18-40)48-36)47-29(22-44-19-24-11-5-2-6-12-24)35(46-21-26-15-9-4-10-16-26)34(23)45-20-25-13-7-3-8-14-25/h2-17,23,28-36,40-43H,18-22H2,1H3/t23-,28-,29-,30-,31+,32+,33+,34-,35-,36+/m1/s1 |
| InChIKey | VOMQQKIRIAIBJV-PACHBCMRSA-N |
| XLogP | 2.71 |
| TPSA | 157.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.75 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |