C28H22F10N2O2 — CID 167058103
1,1,1,3,3,3-hexafluoro-2-[3-fluoro-4-[4-[[4-(trifluoromethyl)spiro[3H-furo[2,3-c]pyridine-2,4'-piperidine]-1'-yl]methyl]phenyl]phenyl]propan-2-ol (PubChem CID 167058103) has the molecular formula C28H22F10N2O2 and a molecular weight of 608.48 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[3-fluoro-4-[4-[[4-(trifluoromethyl)spiro[3H-furo[2,3-c]pyridine-2,4'-piperidine]-1'-yl]methyl]phenyl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[3-fluoro-4-[4-[[4-(trifluoromethyl)spiro[3H-furo[2,3-c]pyridine-2,4'-piperidine]-1'-yl]methyl]phenyl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 167058103 |
| Molecular Formula | C28H22F10N2O2 |
| Molecular Weight | 608.48 g/mol |
| Exact Mass | 608.15 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[3-fluoro-4-[4-[[4-(trifluoromethyl)spiro[3H-furo[2,3-c]pyridine-2,4'-piperidine]-1'-yl]methyl]phenyl]phenyl]propan-2-ol |
| SMILES | OC(c1ccc(-c2ccc(CN3CCC4(CC3)Cc3c(cncc3C(F)(F)F)O4)cc2)c(F)c1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C28H22F10N2O2/c29-22-11-18(25(41,27(33,34)35)28(36,37)38)5-6-19(22)17-3-1-16(2-4-17)15-40-9-7-24(8-10-40)12-20-21(26(30,31)32)13-39-14-23(20)42-24/h1-6,11,13-14,41H,7-10,12,15H2 |
| InChIKey | QPQZEWGWGAGYKU-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.48 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |