C27H24F6N2O3 — CID 167058101
1'-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]spiro[3,7-dihydrofuro[2,3-b]pyridine-2,4'-piperidine]-6-one (PubChem CID 167058101) has the molecular formula C27H24F6N2O3 and a molecular weight of 538.49 g/mol. Its IUPAC name is 1'-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]spiro[3,7-dihydrofuro[2,3-b]pyridine-2,4'-piperidine]-6-one.
| Compound Name | 1'-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]spiro[3,7-dihydrofuro[2,3-b]pyridine-2,4'-piperidine]-6-one |
|---|---|
| PubChem CID | 167058101 |
| Molecular Formula | C27H24F6N2O3 |
| Molecular Weight | 538.49 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | 1'-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]spiro[3,7-dihydrofuro[2,3-b]pyridine-2,4'-piperidine]-6-one |
| SMILES | O=c1ccc2c([nH]1)OC1(CCN(Cc3ccc(-c4ccc(C(O)(C(F)(F)F)C(F)(F)F)cc4)cc3)CC1)C2 |
| InChI | InChI=1S/C27H24F6N2O3/c28-26(29,30)25(37,27(31,32)33)21-8-5-19(6-9-21)18-3-1-17(2-4-18)16-35-13-11-24(12-14-35)15-20-7-10-22(36)34-23(20)38-24/h1-10,37H,11-16H2,(H,34,36) |
| InChIKey | XJXXBLRYKPDGOA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |