C66H52O6S2 — CID 167059644
CID 167059644 (PubChem CID 167059644) has the molecular formula C66H52O6S2 and a molecular weight of 1005.27 g/mol.
| Compound Name | CID 167059644 |
|---|---|
| PubChem CID | 167059644 |
| Molecular Formula | C66H52O6S2 |
| Molecular Weight | 1005.27 g/mol |
| Exact Mass | 1004.32 |
| IUPAC Name | — |
| SMILES | O=C1C(=CC2=CC3C(S2)C2=CC4C=C5OC6(CCCCC6)c6cc(/C=C7\C(=O)c8cc9c(cc8C7=O)CC7CCC=CC7=C9)sc6C5=CC4C=C2OC32CCCCC2)C(=O)c2cc3cc4ccccc4cc3cc21 |
| InChI | InChI=1S/C66H52O6S2/c67-59-47-23-39-19-35-11-3-4-12-36(35)20-40(39)24-48(47)60(68)53(59)31-45-33-55-63(73-45)51-27-44-30-58-52(28-43(44)29-57(51)71-65(55)15-7-1-8-16-65)64-56(66(72-58)17-9-2-10-18-66)34-46(74-64)32-54-61(69)49-25-41-21-37-13-5-6-14-38(37)22-42(41)26-50(49)62(54)70/h3-5,11-13,19-21,23-34,38,43-44,55,63H,1-2,6-10,14-18,22H2/b54-32+ |
| InChIKey | JCSUSVIOYFDSIC-DXLTUSQYSA-N |
| XLogP | 15.30 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1005.27 |
| LogP ≤ 5 | 15.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|