C22H15F6INO3P — CID 167070160
(E)-3-[(6E)-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]-N-iodophosphanyloxyprop-2-enamide (PubChem CID 167070160) has the molecular formula C22H15F6INO3P and a molecular weight of 613.23 g/mol. Its IUPAC name is (E)-3-[(6E)-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]-N-iodophosphanyloxyprop-2-enamide.
| Compound Name | (E)-3-[(6E)-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]-N-iodophosphanyloxyprop-2-enamide |
|---|---|
| PubChem CID | 167070160 |
| Molecular Formula | C22H15F6INO3P |
| Molecular Weight | 613.23 g/mol |
| Exact Mass | 612.97 |
| IUPAC Name | (E)-3-[(6E)-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]-N-iodophosphanyloxyprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)CC/C(=C\c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C2=O)NOPI |
| InChI | InChI=1S/C22H15F6INO3P/c23-21(24,25)16-9-13(10-17(11-16)22(26,27)28)8-15-4-3-14-7-12(1-5-18(14)20(15)32)2-6-19(31)30-33-34-29/h1-2,5-11,34H,3-4H2,(H,30,31)/b6-2+,15-8+ |
| InChIKey | SDOIDEJVKHMGAO-JFNDZESESA-N |
| XLogP | 6.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.23 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|