C28H26F6IN2O4P — CID 167070138
6-[[(E)-3-[(6E)-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]prop-2-enoyl]amino]-N-iodophosphanyloxyhexanamide (PubChem CID 167070138) has the molecular formula C28H26F6IN2O4P and a molecular weight of 726.39 g/mol. Its IUPAC name is 6-[[(E)-3-[(6E)-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]prop-2-enoyl]amino]-N-iodophosphanyloxyhexanamide.
| Compound Name | 6-[[(E)-3-[(6E)-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]prop-2-enoyl]amino]-N-iodophosphanyloxyhexanamide |
|---|---|
| PubChem CID | 167070138 |
| Molecular Formula | C28H26F6IN2O4P |
| Molecular Weight | 726.39 g/mol |
| Exact Mass | 726.06 |
| IUPAC Name | 6-[[(E)-3-[(6E)-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]prop-2-enoyl]amino]-N-iodophosphanyloxyhexanamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)CC/C(=C\c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C2=O)NCCCCCC(=O)NOPI |
| InChI | InChI=1S/C28H26F6IN2O4P/c29-27(30,31)21-14-18(15-22(16-21)28(32,33)34)13-20-8-7-19-12-17(5-9-23(19)26(20)40)6-10-24(38)36-11-3-1-2-4-25(39)37-41-42-35/h5-6,9-10,12-16,42H,1-4,7-8,11H2,(H,36,38)(H,37,39)/b10-6+,20-13+ |
| InChIKey | PCTKTAWNGSWMPM-BXAMIRAZSA-N |
| XLogP | 7.62 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.39 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|