C29H27F6NO4 — CID 155181432
methyl 6-[[(E)-3-[(6E)-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]prop-2-enoyl]amino]hexanoate (PubChem CID 155181432) has the molecular formula C29H27F6NO4 and a molecular weight of 567.53 g/mol. Its IUPAC name is methyl 6-[[(E)-3-[(6E)-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]prop-2-enoyl]amino]hexanoate.
| Compound Name | methyl 6-[[(E)-3-[(6E)-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]prop-2-enoyl]amino]hexanoate |
|---|---|
| PubChem CID | 155181432 |
| Molecular Formula | C29H27F6NO4 |
| Molecular Weight | 567.53 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | methyl 6-[[(E)-3-[(6E)-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]prop-2-enoyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)/C=C/c1ccc2c(c1)CC/C(=C\c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C2=O |
| InChI | InChI=1S/C29H27F6NO4/c1-40-26(38)5-3-2-4-12-36-25(37)11-7-18-6-10-24-20(13-18)8-9-21(27(24)39)14-19-15-22(28(30,31)32)17-23(16-19)29(33,34)35/h6-7,10-11,13-17H,2-5,8-9,12H2,1H3,(H,36,37)/b11-7+,21-14+ |
| InChIKey | UVHYQZWMSPQRQO-WOKFVVJVSA-N |
| XLogP | 6.80 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.53 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|