C26H25F6N3O4 — CID 162618839
7-[[(6E)-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]imino]-N-hydroxy-7-(hydroxyamino)heptanamide (PubChem CID 162618839) has the molecular formula C26H25F6N3O4 and a molecular weight of 557.49 g/mol. Its IUPAC name is 7-[[(6E)-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]imino]-N-hydroxy-7-(hydroxyamino)heptanamide.
| Compound Name | 7-[[(6E)-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]imino]-N-hydroxy-7-(hydroxyamino)heptanamide |
|---|---|
| PubChem CID | 162618839 |
| Molecular Formula | C26H25F6N3O4 |
| Molecular Weight | 557.49 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | 7-[[(6E)-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]imino]-N-hydroxy-7-(hydroxyamino)heptanamide |
| SMILES | O=C(CCCCC/C(=N\c1ccc2c(c1)CC/C(=C\c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C2=O)NO)NO |
| InChI | InChI=1S/C26H25F6N3O4/c27-25(28,29)18-11-15(12-19(14-18)26(30,31)32)10-17-7-6-16-13-20(8-9-21(16)24(17)37)33-22(34-38)4-2-1-3-5-23(36)35-39/h8-14,38-39H,1-7H2,(H,33,34)(H,35,36)/b17-10+ |
| InChIKey | QDWYMIJKHLSKER-LICLKQGHSA-N |
| XLogP | 6.40 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.49 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|