C20H28F3N — CID 167080874
3-(4-methylidenehexan-3-yl)-1-[[4-(trifluoromethyl)phenyl]methyl]piperidine (PubChem CID 167080874) has the molecular formula C20H28F3N and a molecular weight of 339.44 g/mol. Its IUPAC name is 3-(4-methylidenehexan-3-yl)-1-[[4-(trifluoromethyl)phenyl]methyl]piperidine.
| Compound Name | 3-(4-methylidenehexan-3-yl)-1-[[4-(trifluoromethyl)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 167080874 |
| Molecular Formula | C20H28F3N |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 3-(4-methylidenehexan-3-yl)-1-[[4-(trifluoromethyl)phenyl]methyl]piperidine |
| SMILES | C=C(CC)C(CC)C1CCCN(Cc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C20H28F3N/c1-4-15(3)19(5-2)17-7-6-12-24(14-17)13-16-8-10-18(11-9-16)20(21,22)23/h8-11,17,19H,3-7,12-14H2,1-2H3 |
| InChIKey | XOBZQKWWKOJNOP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|