C13H19N3 — CID 167081446
1-N'-[1-(nona-3,5-diynylamino)ethenyl]ethene-1,1-diamine (PubChem CID 167081446) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 1-N'-[1-(nona-3,5-diynylamino)ethenyl]ethene-1,1-diamine.
| Compound Name | 1-N'-[1-(nona-3,5-diynylamino)ethenyl]ethene-1,1-diamine |
|---|---|
| PubChem CID | 167081446 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 1-N'-[1-(nona-3,5-diynylamino)ethenyl]ethene-1,1-diamine |
| SMILES | C=C(N)NC(=C)NCCC#CC#CCCC |
| InChI | InChI=1S/C13H19N3/c1-4-5-6-7-8-9-10-11-15-13(3)16-12(2)14/h15-16H,2-5,10-11,14H2,1H3 |
| InChIKey | AVCBZHCJTOGNIU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|