C42H31N — CID 167084011
N-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-(4-phenylphenyl)hexacyclo[11.11.0.02,21.03,8.09,14.015,20]tetracosa-1(24),2(21),3(8),4,6,9,11,13,15,17,19,22-dodecaen-6-amine (PubChem CID 167084011) has the molecular formula C42H31N and a molecular weight of 549.72 g/mol. Its IUPAC name is N-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-(4-phenylphenyl)hexacyclo[11.11.0.02,21.03,8.09,14.015,20]tetracosa-1(24),2(21),3(8),4,6,9,11,13,15,17,19,22-dodecaen-6-amine.
| Compound Name | N-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-(4-phenylphenyl)hexacyclo[11.11.0.02,21.03,8.09,14.015,20]tetracosa-1(24),2(21),3(8),4,6,9,11,13,15,17,19,22-dodecaen-6-amine |
|---|---|
| PubChem CID | 167084011 |
| Molecular Formula | C42H31N |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | N-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-(4-phenylphenyl)hexacyclo[11.11.0.02,21.03,8.09,14.015,20]tetracosa-1(24),2(21),3(8),4,6,9,11,13,15,17,19,22-dodecaen-6-amine |
| SMILES | C/C=C\C(=C/C)N(c1ccc(-c2ccccc2)cc1)c1ccc2c(c1)-c1cccc3c1-c1ccccc1-c1cccc-3c1-2 |
| InChI | InChI=1S/C42H31N/c1-3-12-30(4-2)43(31-23-21-29(22-24-31)28-13-6-5-7-14-28)32-25-26-39-40(27-32)38-20-11-19-36-37-18-10-17-35(42(37)39)33-15-8-9-16-34(33)41(36)38/h3-27H,1-2H3/b12-3-,30-4+ |
| InChIKey | HPFIGOUYVJYGHF-AQHDHZDRSA-N |
| XLogP | 11.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|