C16H19N2O11P — CID 167094641
[3-[[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]methyl]phenyl]methyl 2-phosphonooxyethyl carbonate (PubChem CID 167094641) has the molecular formula C16H19N2O11P and a molecular weight of 446.31 g/mol. Its IUPAC name is [3-[[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]methyl]phenyl]methyl 2-phosphonooxyethyl carbonate.
| Compound Name | [3-[[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]methyl]phenyl]methyl 2-phosphonooxyethyl carbonate |
|---|---|
| PubChem CID | 167094641 |
| Molecular Formula | C16H19N2O11P |
| Molecular Weight | 446.31 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | [3-[[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]methyl]phenyl]methyl 2-phosphonooxyethyl carbonate |
| SMILES | O=C(NCc1cccc(COC(=O)OCCOP(=O)(O)O)c1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C16H19N2O11P/c19-13-4-5-14(20)18(13)29-15(21)17-9-11-2-1-3-12(8-11)10-27-16(22)26-6-7-28-30(23,24)25/h1-3,8H,4-7,9-10H2,(H,17,21)(H2,23,24,25) |
| InChIKey | ZSHBOWUINWCMBA-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 178.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|