C19H20N6O7 — CID 167094624
(2,5-dioxopyrrolidin-1-yl) N-[[4-[2-[(diaminomethylideneamino)methylamino]-2-oxoethyl]-2-oxochromen-6-yl]methyl]carbamate (PubChem CID 167094624) has the molecular formula C19H20N6O7 and a molecular weight of 444.40 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) N-[[4-[2-[(diaminomethylideneamino)methylamino]-2-oxoethyl]-2-oxochromen-6-yl]methyl]carbamate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) N-[[4-[2-[(diaminomethylideneamino)methylamino]-2-oxoethyl]-2-oxochromen-6-yl]methyl]carbamate |
|---|---|
| PubChem CID | 167094624 |
| Molecular Formula | C19H20N6O7 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) N-[[4-[2-[(diaminomethylideneamino)methylamino]-2-oxoethyl]-2-oxochromen-6-yl]methyl]carbamate |
| SMILES | NC(N)=NCNC(=O)Cc1cc(=O)oc2ccc(CNC(=O)ON3C(=O)CCC3=O)cc12 |
| InChI | InChI=1S/C19H20N6O7/c20-18(21)24-9-23-14(26)6-11-7-17(29)31-13-2-1-10(5-12(11)13)8-22-19(30)32-25-15(27)3-4-16(25)28/h1-2,5,7H,3-4,6,8-9H2,(H,22,30)(H,23,26)(H4,20,21,24) |
| InChIKey | YPMLYTDSEKAZMP-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 199.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|