C20H26N6O6 — CID 167094579
(2-hydroxy-5-oxopyrrolidin-1-yl) N-[[4-[[3-(diaminomethylideneamino)propylamino]methyl]-2-oxochromen-6-yl]methyl]carbamate (PubChem CID 167094579) has the molecular formula C20H26N6O6 and a molecular weight of 446.46 g/mol. Its IUPAC name is (2-hydroxy-5-oxopyrrolidin-1-yl) N-[[4-[[3-(diaminomethylideneamino)propylamino]methyl]-2-oxochromen-6-yl]methyl]carbamate.
| Compound Name | (2-hydroxy-5-oxopyrrolidin-1-yl) N-[[4-[[3-(diaminomethylideneamino)propylamino]methyl]-2-oxochromen-6-yl]methyl]carbamate |
|---|---|
| PubChem CID | 167094579 |
| Molecular Formula | C20H26N6O6 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | (2-hydroxy-5-oxopyrrolidin-1-yl) N-[[4-[[3-(diaminomethylideneamino)propylamino]methyl]-2-oxochromen-6-yl]methyl]carbamate |
| SMILES | NC(N)=NCCCNCc1cc(=O)oc2ccc(CNC(=O)ON3C(=O)CCC3O)cc12 |
| InChI | InChI=1S/C20H26N6O6/c21-19(22)24-7-1-6-23-11-13-9-18(29)31-15-3-2-12(8-14(13)15)10-25-20(30)32-26-16(27)4-5-17(26)28/h2-3,8-9,16,23,27H,1,4-7,10-11H2,(H,25,30)(H4,21,22,24) |
| InChIKey | WRQLGMWRJWUFIJ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 185.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|