C5H8O4Sn — CID 16709545
2,2-dimethyl-1,3,2-dioxastanninane-4,6-dione (PubChem CID 16709545) has the molecular formula C5H8O4Sn and a molecular weight of 250.83 g/mol. Its IUPAC name is 2,2-dimethyl-1,3,2-dioxastanninane-4,6-dione.
| Compound Name | 2,2-dimethyl-1,3,2-dioxastanninane-4,6-dione |
|---|---|
| PubChem CID | 16709545 |
| Molecular Formula | C5H8O4Sn |
| Molecular Weight | 250.83 g/mol |
| Exact Mass | 251.94 |
| IUPAC Name | 2,2-dimethyl-1,3,2-dioxastanninane-4,6-dione |
| SMILES | C[Sn]1(C)OC(=O)CC(=O)O1 |
| InChI | InChI=1S/C3H4O4.2CH3.Sn/c4-2(5)1-3(6)7;;;/h1H2,(H,4,5)(H,6,7);2*1H3;/q;;;+2/p-2 |
| InChIKey | NYIYHHXYWXLRKW-UHFFFAOYSA-L |
| XLogP | 0.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.83 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|