C35H68N2O5S — CID 167155749
[(Z)-non-2-enyl] 4-[[2-(dimethylamino)ethylsulfanyl-hydroxymethyl]-(2-oxo-2-pentadecan-8-yloxyethyl)amino]butanoate (PubChem CID 167155749) has the molecular formula C35H68N2O5S and a molecular weight of 629.01 g/mol. Its IUPAC name is [(Z)-non-2-enyl] 4-[[2-(dimethylamino)ethylsulfanyl-hydroxymethyl]-(2-oxo-2-pentadecan-8-yloxyethyl)amino]butanoate.
| Compound Name | [(Z)-non-2-enyl] 4-[[2-(dimethylamino)ethylsulfanyl-hydroxymethyl]-(2-oxo-2-pentadecan-8-yloxyethyl)amino]butanoate |
|---|---|
| PubChem CID | 167155749 |
| Molecular Formula | C35H68N2O5S |
| Molecular Weight | 629.01 g/mol |
| Exact Mass | 628.48 |
| IUPAC Name | [(Z)-non-2-enyl] 4-[[2-(dimethylamino)ethylsulfanyl-hydroxymethyl]-(2-oxo-2-pentadecan-8-yloxyethyl)amino]butanoate |
| SMILES | CCCCCC/C=C\COC(=O)CCCN(CC(=O)OC(CCCCCCC)CCCCCCC)C(O)SCCN(C)C |
| InChI | InChI=1S/C35H68N2O5S/c1-6-9-12-15-16-19-22-29-41-33(38)26-23-27-37(35(40)43-30-28-36(4)5)31-34(39)42-32(24-20-17-13-10-7-2)25-21-18-14-11-8-3/h19,22,32,35,40H,6-18,20-21,23-31H2,1-5H3/b22-19- |
| InChIKey | GXFYHBLBQOJNRP-QOCHGBHMSA-N |
| XLogP | 8.34 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.01 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|