C13H18F2O — CID 167231877
3-(4,4-dimethylpentan-2-yl)-2,6-difluorophenol (PubChem CID 167231877) has the molecular formula C13H18F2O and a molecular weight of 228.28 g/mol. Its IUPAC name is 3-(4,4-dimethylpentan-2-yl)-2,6-difluorophenol.
| Compound Name | 3-(4,4-dimethylpentan-2-yl)-2,6-difluorophenol |
|---|---|
| PubChem CID | 167231877 |
| Molecular Formula | C13H18F2O |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 3-(4,4-dimethylpentan-2-yl)-2,6-difluorophenol |
| SMILES | CC(CC(C)(C)C)c1ccc(F)c(O)c1F |
| InChI | InChI=1S/C13H18F2O/c1-8(7-13(2,3)4)9-5-6-10(14)12(16)11(9)15/h5-6,8,16H,7H2,1-4H3 |
| InChIKey | ZKZLISXMSIXMKH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |