C27H46O4 — CID 16726529
(2R,4S,6R)-4-[3-(methoxymethoxy)-3-methylbutyl]-3,3-dimethyl-6-(3-methylbut-2-enyl)-2-(2-methylpropanoyl)-2-prop-2-enylcyclohexan-1-one (PubChem CID 16726529) has the molecular formula C27H46O4 and a molecular weight of 434.66 g/mol. Its IUPAC name is (2R,4S,6R)-4-[3-(methoxymethoxy)-3-methylbutyl]-3,3-dimethyl-6-(3-methylbut-2-enyl)-2-(2-methylpropanoyl)-2-prop-2-enylcyclohexan-1-one.
| Compound Name | (2R,4S,6R)-4-[3-(methoxymethoxy)-3-methylbutyl]-3,3-dimethyl-6-(3-methylbut-2-enyl)-2-(2-methylpropanoyl)-2-prop-2-enylcyclohexan-1-one |
|---|---|
| PubChem CID | 16726529 |
| Molecular Formula | C27H46O4 |
| Molecular Weight | 434.66 g/mol |
| Exact Mass | 434.34 |
| IUPAC Name | (2R,4S,6R)-4-[3-(methoxymethoxy)-3-methylbutyl]-3,3-dimethyl-6-(3-methylbut-2-enyl)-2-(2-methylpropanoyl)-2-prop-2-enylcyclohexan-1-one |
| SMILES | C=CC[C@@]1(C(=O)C(C)C)C(=O)[C@H](CC=C(C)C)C[C@H](CCC(C)(C)OCOC)C1(C)C |
| InChI | InChI=1S/C27H46O4/c1-11-15-27(23(28)20(4)5)24(29)21(13-12-19(2)3)17-22(26(27,8)9)14-16-25(6,7)31-18-30-10/h11-12,20-22H,1,13-18H2,2-10H3/t21-,22+,27-/m1/s1 |
| InChIKey | MBBQQSRVUPTEQY-UMTXDNHDSA-N |
| XLogP | 6.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.66 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|