C12H18N6O5 — CID 167267075
[(1R,2R,4S,6S)-2-acetyloxy-3-azido-6-(azidomethyl)-4-methoxycyclohexyl] acetate (PubChem CID 167267075) has the molecular formula C12H18N6O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is [(1R,2R,4S,6S)-2-acetyloxy-3-azido-6-(azidomethyl)-4-methoxycyclohexyl] acetate.
| Compound Name | [(1R,2R,4S,6S)-2-acetyloxy-3-azido-6-(azidomethyl)-4-methoxycyclohexyl] acetate |
|---|---|
| PubChem CID | 167267075 |
| Molecular Formula | C12H18N6O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | [(1R,2R,4S,6S)-2-acetyloxy-3-azido-6-(azidomethyl)-4-methoxycyclohexyl] acetate |
| SMILES | CO[C@H]1C[C@@H](CN=[N+]=[N-])[C@@H](OC(C)=O)[C@H](OC(C)=O)C1N=[N+]=[N-] |
| InChI | InChI=1S/C12H18N6O5/c1-6(19)22-11-8(5-15-17-13)4-9(21-3)10(16-18-14)12(11)23-7(2)20/h8-12H,4-5H2,1-3H3/t8-,9-,10?,11+,12+/m0/s1 |
| InChIKey | XADVZAYLEONVAS-HIQXDMJCSA-N |
| XLogP | 1.87 |
| TPSA | 159.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|